Why pc gaming SHOULD die.
Tom's Hardware: Over 1.4 million members in 6 different countries available to answer all your high-tech questions. Sign up now! Its free!
More related threads to : Why pc gaming SHOULD die.
(11/07/2009) Dual-monitor and gaming(11/06/2009) Why doesn't this game work for mypc?
(11/10/2009) Is pc gaming still alive? like it was back in 02-03'(10/31/2009) Why is my Oblivion game saying that Windows has a problem and needs to shut down
(11/02/2009) I HATE PC GAMING!!!!11(10/28/2009) What upcoming game should I buy? (PC of course)
(10/26/2009) Gaming Mouse Advice(11/11/2009) Rate my set up for gaming.
(10/24/2009) My wirless problem when gaming(10/21/2009) Mod.Warefare2 online gaming
(11/06/2009) Blue Screens during Gaming.(11/01/2009) Why Do We Need To "Install" PC Games?
(10/14/2009) Why is my english version of Half life 2 in spanish?(10/13/2009) Gaming, Monitors, Hardware, - HDTV - RAM - 5870 - etc
(10/10/2009) Should i trade in warhammer 2 for lotr conquest at eb games?(10/05/2009) [PC Gaming] Upgrades for Aion.
(09/29/2009) How to examine regarding to choose the best gaming computers?(09/29/2009) Gaming
(09/20/2009) G15, good gaming keyboard?(10/12/2009) Best laptop gaming september 2009
(09/15/2009) Gaming pc setup(09/15/2009) Why does Oblivion continue to crash?
(09/14/2009) I am building a gaming pc on a limited budget(09/02/2009) Price-Performance C2D X25-M gaming PC + 23 hardware questions
(09/02/2009) Which Laptop is better for gaming?(09/21/2009) Classic Gaming vs Modern Gaming
(08/30/2009) Should I buy Crysis, Flaoout 3 Broken Steel, or something else?(08/27/2009) Game Studies: Personality and Gaming Preferences Questionnaire
(09/14/2009) Razer Salmosa: Why Would I Get One?(08/27/2009) Gaming
(08/24/2009) Will these PC specs make a good gaming computer?(09/02/2009) Max res during gaming
(08/23/2009) Will these pc specs make a very good gaming system?(11/26/2009) Should I buy a 360, a ps3, or a wii+?
(08/22/2009) Should it lag?(10/30/2009) Gaming rig--XP, Linux, or 7
(09/06/2009) A good gaming pc or xbox 360(08/11/2009) Good for Gaming?
(08/13/2009) Need some opinions on a gaming mouse(08/19/2009) Is my Pc good or great for Gaming?
(08/10/2009) Why the hate for Crysis???(08/12/2009) Carpal tunnel from gaming?
(07/22/2009) Advice and Opinion for PC Gaming(07/19/2009) Gaming - Render Node
(07/16/2009) Microsoft need pc gaming to be dead(08/04/2009) How good is my Computer for gaming?
(07/15/2009) Tweaking and Optimizing Your PC for Gaming(07/09/2009) Looking for a decent gaming laptop, what do i choose?
(07/10/2009) Is my PC O.K for Gaming(07/02/2009) How does a internet phone affect online gaming?
(06/26/2009) PC gaming is dead huh?(06/25/2009) WHY IS CRYSIS JERKING?!?
(06/20/2009) Microsoft Sidewinder X3 Gaming Mouse(06/19/2009) Laptop t3400 and virtual machine can it be done for gaming
(06/19/2009) Why can i play a 16 bit pc game on windows vista 64 bit(06/10/2009) Why Valve Won't Develop for the PS3
(06/11/2009) Why is Crysis lagging sooo badly for me???(06/08/2009) Should i buy a PS2 ?
(06/15/2009) Why are my encodings soundless?? (L4D Video Sample Included)(06/09/2009) Why does it ask me for disc when i play crysis?
(05/23/2009) Asus Gaming(05/20/2009) Gaming Video Contest
(05/29/2009) Why not Splitscreen? if L4D can do it, why not other games?(05/14/2009) Do I upgrade from XP 32bit for new gaming rig?
(05/24/2009) Healthy Gaming Tips? Personal Gaming Records(06/27/2009) Why is Halo critically acclaimed and popular?
(05/13/2009) Why Doesn't My Steam Login Work on Website?(05/09/2009) Halp! Gaming rig under $900
(05/14/2009) Must-Have Gaming Peripherals(04/29/2009) Gaming conference
(05/20/2009) Why PC Gaming is Awesome(10/26/2009) CPU vs GPU? what should be the 1st priority
(04/24/2009) Q9550 and a GTX 295. What games should/shouldn't i play on it.(07/19/2009) Gaming PC Vs. Xbox360
(04/18/2009) How To make my low spec laptop for high graphic gaming?(04/15/2009) Unknown 50% drop in gaming performance in Vista 64
(06/07/2009) Best gaming headset(04/05/2009) Why can i not get 16 in AA?
(04/05/2009) Crytek Supporting S-3D Gaming!(03/29/2009) Is anyone intrested in renting a gaming or dedicated server?
(10/14/2009) Long term gaming system?(03/28/2009) Best FPS Gaming Mouse?
(03/28/2009) Onlive! the death of gaming as we know it ?(08/27/2009) Gaming router suggestions?
(03/30/2009) Why they do this to us(03/21/2009) Gaming pc
(03/19/2009) MMORPG Windowed Gaming - Crash(03/17/2009) Overall System Performance Question vs Gaming
(03/16/2009) Looking to build a gaming PC(03/15/2009) Why???
(03/10/2009) Gaming on VW37L Vizio 37"(05/27/2009) Best gaming laptop under 3000
(03/11/2009) New HD TV + PS3? What resolution should be run?(09/28/2009) Where my bottleneck? (PC Gaming)
(03/06/2009) WHY PC HANGS(03/04/2009) Gaming Performance
(03/02/2009) Possible: HTPC (small form factor) AND gaming?(02/16/2009) Dual Gaming without dualhead2go?
(03/01/2009) Gaming Keyboard under $50(02/14/2009) Why do they forget about pc
(11/12/2009) Best gaming mouse?(02/10/2009) Dual monitors and gaming
(02/14/2009) Why cant anyone make a real combat morrowind mod(02/12/2009) GAMING AUDIO QUESTION
(10/03/2009) CRT or LCD for gaming and its native res?(02/10/2009) Why is my gfx card is beeping while playing Assassin's Creed?
(02/07/2009) I'm nervous about this custom built CPU I bought for gaming(02/03/2009) PC Gaming Headset
(02/08/2009) What should I upg to play GTAIV and other games in general..(01/28/2009) Razer - DeathAdder Gaming Mouse or Saitek light up keyboard
(01/30/2009) $625 gaming PC(04/27/2009) High-end gaming computer with low fps
(01/28/2009) AMD Fusion for Gaming(02/18/2009) Gaming microphone
(01/15/2009) Decent Gaming Monitor(01/14/2009) Gaming Thoughts?
(01/14/2009) Buying a new computer for Gaming, reuqire help.(01/14/2009) Gaming, To Vista or Not to Vista
(01/12/2009) Is it worth using AMD Fusion while gaming?(01/15/2009) Why are less pc games being ported from the consoles
(01/13/2009) Why dosbox for old games(01/09/2009) I just rented TDU and had fun with it. Should I buy it?
(01/09/2009) Vista Gaming Question(08/09/2009) Why is World of Warcraft so popular?!
(12/31/2008) PC Gaming Help!(03/04/2009) Red Ring of Death - What should I do?
(01/08/2009) Need Gaming Recommendations...(12/19/2008) Pc gaming web sites
(12/19/2008) Gaming network card(12/22/2008) Rate my Future Gaming PC
(12/17/2008) What should I buy to play IRacing.com(12/18/2008) Gaming Problem
(12/15/2008) Seeking advice about crashes during gaming(12/15/2008) Best cheap gaming headset?
(12/11/2008) [HELP] FSX Problem And Help To Built A Gaming PC For FSX(12/08/2008) Future proofing my gaming PC?
(12/03/2008) Top 5 Gaming Headsets?(12/05/2008) Suggestions for PC Gaming Chair?
(11/28/2008) Which gamepad should I get?(11/20/2008) Gaming Headset
(11/21/2008) Side-Quest: Why Cooperative Play Rocks(11/21/2008) Does highend graphics card need for 1280x1024 & DirectX 9.0c gaming?
(11/15/2008) Please give advice on upgrading for PC gaming(11/15/2008) Why is my Lite on Sata drive not reading certain games
(11/19/2008) Why do parents hate games?(12/04/2008) Best Tv for console gaming?
(11/08/2008) Which is ideal Windows for best performance for gaming?(11/12/2008) Gaming controllers
(11/07/2008) Cuddles Vista 64 Guide to Gaming(11/06/2008) Should gams with non-revocable installs be classified as rentals?
(11/06/2008) Why don't they make long games anymore?(11/04/2008) Is this good for gaming?
(11/04/2008) Pc gaming for $2500(10/14/2009) 32-bit or 64-bit Windows Vista for gaming?
(10/28/2008) AMD Acknowledges 3D Gaming and Gamers Determine Industry(10/21/2008) Will my system be any good for gaming?
(10/16/2008) How's this for a beastly gaming rig?(12/15/2008) Why can I run every game but Spore locks up my computer?
(10/17/2008) Which component of my pc should I upgrade?(10/09/2008) Suggestions needed for Bad Ass gaming PC!
(10/04/2008) Some Rare Good PC Gaming News: 2k9 Coming for PC(12/26/2008) LAN Gaming Question
(05/15/2009) Why Windows 7 is going to fail for gaming and more...(09/30/2008) Side-Quest: Is Gaming Immune to Attack?
(10/08/2008) Wierless mouse for gaming: USB vs. Bluetooth(10/26/2009) Gaming on a Quadro FX3700m
(09/24/2008) **New Gaming PC! (help)**(09/19/2008) Gaming
(09/19/2008) Which system should i get for gaming? please let me know asap!(09/15/2008) GFX cards for FPS gaming?
(09/19/2008) What FPS Should I be getting on games like COD4 and TF2 with this rig(10/03/2008) PC Gaming is now pathetic
(09/11/2008) future of gaming?(08/29/2008) Deciding Which Games I should get for my new gaming PC :)
(08/30/2008) Will this make for a good gaming PC?(08/29/2008) Logitech Profiler no go Crysis on XP Pro X64. WHY?
(09/09/2008) This is very hurtful for pc gaming(08/30/2008) PC Gaming: How to Bring the Industry Back
(08/23/2008) What have I missed/Should I build a new pc(09/05/2008) Why do I lost sound on Vista in games?
(11/17/2008) Wait until Intel i7 for new gaming PC?(08/22/2008) PS3 or Gaming Rig?
(08/23/2008) I need a good wireless gaming mouse(04/03/2009) The future of "Terminator" in PC gaming?
(08/18/2008) Wait until Intels Larrabee to build new gaming system?(08/17/2008) Is this computer good for gaming?
(08/15/2008) Ubisoft CEO on PC Gaming, DRM and More(08/13/2008) Should i sell my PS3?
(08/19/2008) Biggest bottleneck for my gaming pc?(08/02/2008) Is this the spark that PC gaming needs to be ignited?
(08/25/2008) Best Gaming Headset under 150.00?(08/23/2008) Why the demand for very high FPS in games?
(07/29/2008) Gaming: Vista Premium vs Business(07/27/2008) Best Gaming PC company?
(07/24/2008) 64bit Gaming...the void?(07/22/2008) Which of these games should I start next?
(02/11/2009) help upgradingmy pc into a gaming monster..(07/29/2008) I've burned my PSU 2 times while gaming! HELP!
(11/04/2009) Is Microsoft killing PC gaming? (not another one of those posts!)(07/17/2008) Why does Activision/Blizzard make sense?
(07/07/2008) The pc gaming market(07/15/2008) Crysis stutters on my new rig. Why?
(07/03/2008) Valve Comments on the Future of PC Gaming(06/26/2008) Game developers should learn from shadowbane
(06/23/2008) Whats a good gaming head set?(06/20/2008) gaming keyboard with built-in microcontroller and firmware
(07/08/2008) Mass Effect & DRM - Should I be disappointed?(06/21/2008) Worth the $100 to go 64-bit gaming?
(06/19/2008) Awful gaming performance(06/12/2008) Graphics Card Solution for Gaming/Home Office Setup
(06/12/2008) This year, in gaming.. WHOOSH!(06/10/2008) x64 Gaming
(06/08/2008) PC and XBOX 360 LAN Gaming(06/25/2008) Advent of Multi-Core Gaming..
(06/05/2008) Gaming machine black screens(06/09/2008) Gaming Graphics Freezes
(06/23/2008) G7 Gaming Mouse(06/03/2008) pc gaming is becoming extremely harD!!!
(06/04/2008) Gaming Rig(06/05/2008) COD4 on my new PC - is this as it should be?
(06/12/2008) advice on gaming mouse and keyboard(05/30/2008) Want to buy Wireless Gaming Mouse/Advice please
(05/30/2008) Need help in acc for PC Gaming(06/07/2008) PC Gaming not dying - Valve
(05/16/2008) Gaming Case(05/15/2008) Hardware Advice For Gaming
(05/16/2008) Best PC Gamepad Controller and Why?(05/14/2008) Which version is better for gaming
(05/15/2008) Gaming problem(07/25/2009) Who is to blame for absurd DRM and the 'death' of PC gaming?
(05/09/2008) Another take on why pc gaming is in trouble!(09/21/2009) The real reason 'PC gaming is dying'
(05/08/2008) Why can't I run crysis at high settings?(06/13/2008) Can you recommend: a new gaming mouse, mouse pad & headphones for me?
(05/04/2008) Why Movie Tie-In Games Suck(04/25/2008) flash gaming tutorials
(04/20/2008) is this good for online and offline gaming(04/14/2008) This Week in Gaming
(04/09/2008) UPGRADING CPU MOSTLY FOR GAMING (FSX) E8500 VS Q9450???(03/31/2008) Bill Gates trying to destroy PC gaming!!!
(03/30/2008) Upgrading CPU Mostly For Gaming (FSX) Any Suggestions(04/02/2008) Why all the PC game bashing? PC > consoles
(03/07/2009) PC gaming on Win XP pro 64 bit(06/13/2008) Why Video Game Stories are "Stupid"
(03/28/2008) Multithreaded gaming coming any time soon(04/13/2008) "Consoles as We Know Them are Gone", the bright future of PC Gaming
(03/21/2008) gaming on "ultra-portables"(04/26/2008) PC Gaming Dead!
(03/14/2008) Console or PC gaming?(03/12/2008) Another Dual Core gaming issue
(03/08/2008) Gaming's Biggest Disasters: E.T. the Game(04/02/2008) Another PC only gaming company dies...
(04/07/2008) 64 Bit CPUS and PC Gaming(02/21/2008) GDC 08: Can These Men Save PC Gaming?
(02/20/2008) Is this PC suitable for gaming?(03/01/2008) CliffyB Disses PC Gaming
(02/14/2008) 19 or 22" monitors gaming quality(11/16/2008) Vuzix VR920: Gaming In 3D?
(02/13/2008) Gaming PC(02/16/2008) Hi guys, i need a gaming pc help please
(02/18/2008) Is the PC dying as a gaming platform???(01/29/2008) Which games should TomsH use for benchmarking?
(01/23/2008) PC gaming on an HDTV.(01/23/2008) PC Gaming Centre
(01/24/2008) How much latency is too much for Online Gaming?(01/17/2008) Gaming PC Parts for sale- chopping up my rig for you!
(01/16/2008) 4 player gaming(01/25/2008) PC Gaming /Console Gaming cost in the future
(02/11/2008) Should i buy a 360 now...(01/12/2008) What FPS should I be getting...?
(10/02/2009) Why in the Hell do people play WOW?(05/02/2009) Which should I upgrade... CPU or Video Card for WoW
(12/31/2007) Face of modern gaming?(12/18/2007) Need help gaming away from monitor
(12/14/2007) Gaming in Vista(12/11/2007) gaming resolution
(12/25/2007) Server 2003 & gaming(12/11/2007) PC gaming COD4
(12/28/2007) Dual Processor Gaming Question(09/11/2009) How to close programs and services before gaming?
(12/04/2007) Crysis: should I update dhe Graphic Card or just the OS?(12/02/2007) am I getting the fps I should be in Crysis?
(12/03/2007) Dual Monitor Gaming(12/03/2007) Traction Radio Mixes Gaming and Music
(11/29/2007) most durable USB gaming pad(12/17/2007) Good surround gaming headset??
(11/30/2007) Best Gaming Performance Upgrade(11/29/2007) PC games that SHOULD have been ported to console
(04/01/2008) PC Gaming, too expensive!!(11/06/2007) Random Crash & Stutter Sound
(11/04/2007) [PC Gaming] EA Store FAQ(10/31/2007) dual boot question for gaming
(10/30/2007) Looking for a small gaming desktop under £750/$1500....(10/30/2007) Should I Buy PS3 or UPGRADE MY PC??
(10/30/2007) Video Games Live: the Music of Gaming(10/30/2007) Vista Ultimate Gaming Problem?
(10/17/2007) Why isn't American Conquest More Popular?(10/30/2007) Why was HL2 E2 in a Orange Box!
(11/06/2007) gaming problem(10/17/2007) is this Monitor good for Gaming
(10/16/2007) Periodic FPS drop while gaming, what can it be?(10/11/2007) Gaming Headset
(10/05/2007) Vista Gaming Help!!(10/03/2007) Why does the PC gaming industry make it so hard to be honest?
(11/01/2007) Sad state of computer gaming(10/06/2007) Gaming on Vista Ultimate 64Bit
(09/27/2007) Breath new life into my gaming rig?(01/07/2009) Raid and Gaming
(09/14/2007) Why will Bioshock not start?(05/04/2008) Looking for suggestions for a good gaming keyboard and mouse.
(09/18/2007) 3 Reasons PC Gaming is Destined to Fail(09/13/2007) Why Buy a Gaming Keyboard?
(09/01/2007) Are These Mice Good for Gaming?(07/02/2009) Opinions of RTS for LAN gaming
(08/22/2007) PC prob when gaming...(08/18/2007) SHOULD I WAIT TO BUY A NEW GAMING PC?!?!
(08/22/2007) Far Cry. Why is it lagging!(08/13/2007) Gamepad or Gaming Keyboard ???
(11/30/2007) Steam games gaming life...(08/05/2007) Why is my raptor slowing oblivion?
(08/04/2007) HELP: TROUBLESHOOT - PC SWITCHES OFF WHILE GAMING(08/24/2007) PC gaming resolution question
(08/07/2007) Why would anyone buy at Console 1280 x 720?(08/11/2007) Its PC gaming really going to end?
(08/08/2007) Which one is best for gaming "Optical or Laser!!!"(05/27/2009) Gaming Laptop Question
(07/23/2007) mid priced gaming system(08/17/2007) Why don't they put CD keys on the CD cover?
(08/19/2007) Are gaming PCs worth the price?(07/11/2007) Gaming Highlights from 2007 - So Far
(07/11/2007) Online Gaming Problem(07/01/2007) Will gaming on Vista Get any better?
(06/28/2007) Gaming Keyboard and Mouse????(06/15/2007) Ping and Graphic issue w/ Battlefield 2 online multi gaming.
(06/18/2007) Gaming on a 22inch wide screen LCD monitor?(06/06/2007) Future Proofing My Gaming Rig
(06/13/2007) Gaming and Poor Sportsmanship(06/12/2007) Should game be installed on separate HD?
(05/14/2007) Vista & Gaming(05/26/2007) SupCom... Why so system intensive... LAG on 6-10 player LAN
(06/21/2007) Why is Counter Strike Source So Popular?(05/03/2007) In need of some advise X2 Athlon gaming performance
(05/07/2007) Need a PS3 forum under console gaming section(12/24/2008) Which software is best for talking to friends while gaming?
(04/25/2007) In dire need of help! NEED MY DOSE OF GAMING!(04/04/2007) Trying to start a gaming community
(03/24/2007) Why do my games keep randomly freezing?(03/10/2007) Is this the end of Console gaming?
(03/17/2007) HELP GETTING INTO PC GAMING(04/11/2007) WHY WONT THIS WORK!?!?!?!? PLEASE HELP!!
(03/06/2007) 16:9 gaming on PC(02/22/2007) PC Gaming and Technology Writing Contest!
(02/21/2007) Vista Pwaned my gaming!(02/28/2007) Gaming Mouse Review: The Fanatec Headshot Controller
(02/14/2007) online rental vs. ownership (new/used) vs. pc gaming(02/16/2007) Why doesn't Team Fortress 2 have any females?
(02/06/2007) Tom Mustaine Talks About SiN Episodes, Severity and Why He Left Ritual(03/17/2007) The PS3 Why You SHOULD GET ONE
(02/02/2007) Quad or Dual Core for gaming today?(01/26/2007) HD gaming poll
(12/10/2007) Fatal1ty on DirecTV's Pro Gaming League, Retirement and Windows Vista(01/25/2007) Effect of Vista on Gaming
(02/14/2007) Howdy guys - gaming issues with COV (grahpical/cpu)(01/18/2007) The $15,000 Gaming Chair and Other Gear from CES 2007
(01/14/2007) Buying a Gaming Rig for under $1000(01/11/2007) Question - gaming with Intel Core 2 Duo 6400
(02/17/2007) Ambilight gaming(01/07/2007) Wireless gaming headset ?
(01/07/2007) Extern Hard Drive Gaming, HELP PLEASE??(01/09/2007) Gaming Laptop around $1000?
(01/03/2007) 10 Things You Didn't Know About Professional Gaming(04/16/2007) Back to PC gaming after a 4 year hiatus- recommendations?
(12/20/2006) An Inside Look at Professional Gaming with CPL Founder Angel Munoz(11/30/2006) Unreal Anthology Boxset (what you should know!)
(06/25/2007) Why won't LucasArts make a modern Tie Fighter game ?(12/06/2006) Counter-Point: Are Rupert Murdoch and Big Business Good for Gaming?
(11/13/2006) LAN Gaming Center in Metairie, LA(11/09/2006) Harlan Ellison Interviews Ronald D. Moore on Why "Battlestar Galactica" is So Da
(11/15/2006) MMR: Why Video Games Based on Movies Aren't Working(11/12/2006) LAN Gaming with WAN Access? Is it possible?
(11/11/2006) BEST GAMING CPU FOR $200?!(10/20/2006) They should have called it "Battlefield 2138"
(10/18/2006) Gaming on Server 2003?(10/17/2006) Gaming LCD? Help!
(09/23/2006) Multiplayer gaming setup(09/17/2006) Why are my steam games closing down when i join a server?
(09/07/2006) dual screen gaming?(09/06/2006) Why such bad ping?
(10/28/2008) Gaming\'s New Drug Culture: Sex, Drugs and Counter-Strike(11/26/2008) MMR: Is MTV\'s Gaming Effort a Sign of the Apocalypse?
(09/05/2006) A Multiplayer Melee on Episodic Gaming(08/09/2006) MAC gaming with BootCamp
(08/18/2006) Which RTS should i buy?(08/11/2006) Widescreen Gaming effects on performance???
(08/10/2006) Help with gaming resolutions.(08/20/2006) Retro gaming without using a ROM
(08/02/2006) THGC Gaming Crew(08/13/2006) MMR: Can Solar Power Reduce the Cost of Gaming?
(09/04/2006) Buying the right gaming mouse??(08/04/2006) DSL Speeds and online Gaming
(07/27/2006) Gaming mice?(08/03/2006) Planning a new gaming rig
(11/26/2008) old iMac gaming(07/27/2006) Decent gaming rig? On a scale of 1-10....1 being the worst
(11/26/2008) Aspyr\'s Gamerhood Takes Aim at Mac Gaming(07/19/2006) Gaming Across the Pacific Rim
(08/08/2006) Gaming Headset for PC(07/28/2006) Alienware, best for gaming?
(07/06/2006) MAC Gaming (now intel)(07/08/2006) gaming computer
(07/07/2006) need help deciding for a LCD HD TV for gaming(06/13/2006) headset for gaming
(11/26/2006) Monday Morning Rundown: Ten Reasons Why You Don't Need a PlayStation 3(06/06/2006) Should I buy the physics card or a sound card?
(06/01/2006) Why is that ?(05/30/2006) Gaming Resolution Help
(05/24/2006) For the Gaming Industry, Inclusion Isn't in the Cards(08/21/2006) Gaming Monitor 21 inch CRT or 19 LCD
(05/24/2006) Does PC Gaming Have a Future?(05/08/2006) A Multiplayer Melee on Professional Gaming
(05/13/2006) Gaming Laptops and Oblivion(05/03/2006) Gaming Machine Opinions (what I want to build)
(04/20/2006) Is anyone Dual Monitor gaming??(04/20/2006) is PC gaming is dying out!
(04/28/2006) Existencial question: PC or Gaming Consoles?(no spam pls)(06/04/2009) Horrible FPS during Oblivion/FEAR Gameplay. Why??
(04/06/2006) Why is Oblivion running slow?(03/22/2006) Minimum for gaming
(03/30/2006) smooth gaming with 7800 gtx??don't think so...(03/10/2006) Hotter gaming chick
(03/03/2006) Why won't the tickrate increase?(06/13/2006) Why Sony Remodel the PS2?
(11/06/2006) So... Which games should I play?(02/27/2006) Vista as a gaming Platform???
(02/08/2006) How do I free up system resources for gaming?(02/10/2006) Violent gaming article on twitchguru...
(02/22/2006) PC gaming, general question.(01/10/2006) Recording Online gaming
(12/30/2005) Why is Elhan so angry?(12/30/2005) Gaming/Technology Community
(12/02/2005) LCD TV for gaming(01/23/2006) A Return to Retro Gaming?
(08/15/2005) Should I make peace?(08/29/2005) Should I head for Philosophy first?
(01/30/2005) Why I can't host in Civ3-PTW?(09/25/2004) Online Gaming
(08/05/2004) Why don't you and him fight, I'll direct traffic.(08/06/2005) Why am I doing this?
(04/19/2005) Why do players do that?(02/07/2005) Which OS items should I pick up?
(01/21/2005) Why I think Blizzard had released D3 already(12/01/2004) D2 in German game mag: Why that patch?
(09/13/2005) New Gaming Site(09/13/2005) New Gaming Site
(06/17/2005) I think Super Mario should retire !!!(05/06/2005) New Online Gaming Auction
(03/01/2005) Why was Castlevania: Legends removed from continuity?(09/13/2005) New Gaming Site
(08/28/2005) East Coast Gaming Expo 2005(08/26/2005) Tech: Indy heat u105. Should there be a ic there?.
(08/10/2005) East Coast Gaming Expo 2005(08/10/2005) Why won't Q*bert save high scores?
(07/17/2005) Tech: Why is this???(07/05/2005) Cool...It's a Centipede Cab. Should I Restore?
(06/28/2005) What Should I Expect to Pay?(06/25/2005) I should sell my games and start a new hobby!
(06/09/2005) Tech: 'Antennae' on some of the older games. Why?(05/06/2005) TECH: Why Roadblasters or Roadrunner might not work on you..
(04/26/2005) North Texas Classic gaming competition(04/02/2005) FA:LAST DAY-Home Arcade Gaming System(HGA)
(03/30/2005) Why Are All The Good Deals In Cali. When I'm In MI? But I ..(03/26/2005) FA:Home Arcade Gaming System(HGA)
(03/15/2005) FS:Home Gaming Arcade System(03/09/2005) Why did the Tac-Scan only sell for $250?
(08/16/2005) participation in gaming show, end of Aug, Bellevue, WA(07/27/2005) Free Gaming System
(04/02/2005) FA:LAST DAY-Home Arcade Gaming System(HGA)(03/26/2005) FA:Home Arcade Gaming System(HGA)
(03/15/2005) FS:Home Gaming Arcade System(04/18/2005) Hey- I want a free IPOD, Why not you.
(04/06/2005) Why are disks called drives?(01/20/2005) What is YOUR ideal gaming store/space?
(10/21/2004) Article -- O Brave New World! Why the Type I.5 Changes Are..(01/18/2005) What is YOUR ideal gaming store/space?
(09/09/2005) Knoxville TN gaming store has moved(03/24/2005) All-Day MTG Gaming Event New Jersey
(02/07/2005) Should there always be a foil in a tournament pack?(02/04/2005) What is YOUR ideal gaming store/space?
(12/21/2004) Why you buy too many Magic cards(09/27/2004) Why do people steal!!!
(08/27/2005) Sanctioned Tournament & Demos at Canadian National Gaming ..(04/14/2005) Why all the double-postings?
(02/22/2005) [LSJ] Why a new clan in KMW?(02/20/2005) [newbie] Which PDs should I use?
(02/21/2005) Why on earth has WW not reprinted DECAPITATE?(06/19/2005) [Redemption] [Announce] gaming ministry in southern wv
(01/18/2005) What is YOUR ideal gaming store/space?(05/30/2004) -=S5=- European Gaming Community
(09/27/2005) Why can't rogues steal? 


Sponsored links
  • Ask the community now
  • Publish
Ad