Why is World of Warcraft so popular?!
Tom's Hardware: Over 1.4 million members in 6 different countries available to answer all your high-tech questions. Sign up now! Its free!
More related threads to : Why is World of Warcraft so popular?!
(09/15/2009) Why does Oblivion continue to crash?(09/11/2009) Warcraft 3 Tft. Low fps with gtx 260 :[
(09/04/2009) CoD - World at war - crash on Vista(09/14/2009) Razer Salmosa: Why Would I Get One?
(08/26/2009) All programs > world of warcraft(08/04/2009) World of Warcraft low fps all the time.
(08/10/2009) Why the hate for Crysis???(07/30/2009) Call of Duty World at War process question
(10/29/2009) World of Warcraft computer build(09/29/2009) World of Warcraft Black Screen Crashes
(06/25/2009) WHY IS CRYSIS JERKING?!?(06/18/2009) World in Conflict No Hope Mod problem
(06/19/2009) Why can i play a 16 bit pc game on windows vista 64 bit(06/10/2009) Why Valve Won't Develop for the PS3
(06/11/2009) Why is Crysis lagging sooo badly for me???(06/15/2009) Why are my encodings soundless?? (L4D Video Sample Included)
(06/04/2009) Call Of Duty: World at War - MP Game Stops Working(06/09/2009) Why does it ask me for disc when i play crysis?
(05/19/2009) Sims 3 Torrent Becoming Popular(05/19/2009) Low FPS in world of warcraft
(05/29/2009) Why not Splitscreen? if L4D can do it, why not other games?(06/27/2009) Why is Halo critically acclaimed and popular?
(05/13/2009) Why Doesn't My Steam Login Work on Website?(05/20/2009) Why PC Gaming is Awesome
(04/14/2009) AMD CyberFusion 2009 broke NVision 2008 world record(04/08/2009) Warcraft III 64 bit custom crash
(04/05/2009) Why can i not get 16 in AA?(04/01/2009) Weapons of the next world
(04/01/2009) Warcraft 3 performace(03/30/2009) Why they do this to us
(03/25/2009) Call of Duty World at War install gets stuck(03/15/2009) Why???
(03/08/2009) World Of Goo(03/06/2009) WHY PC HANGS
(10/14/2009) Call of duty world at war surround problem(02/23/2009) Warcraft III Error
(07/16/2009) Problem with Call of Duty World At War(02/14/2009) Why do they forget about pc
(02/14/2009) Why cant anyone make a real combat morrowind mod(02/10/2009) Why is my gfx card is beeping while playing Assassin's Creed?
(02/08/2009) Call of Duty World at War to patch v1.2 Problem(04/09/2009) World of Warcraft video settings?
(02/05/2009) World of warcraft mistakes(01/15/2009) Why are less pc games being ported from the consoles
(01/13/2009) Why dosbox for old games(01/09/2009) Giving up on World at War
(01/07/2009) Just finished world at war(09/09/2009) COD 5: World At War - Lag In x64 Bit Vista!
(01/08/2009) Why pc gaming SHOULD die.(12/12/2008) World of warcraft - 260 or 4870
(12/06/2008) Call of Duty: World at War Review(11/21/2008) Side-Quest: Why Cooperative Play Rocks
(11/15/2008) Why is my Lite on Sata drive not reading certain games(11/19/2008) Why do parents hate games?
(11/06/2008) Why don't they make long games anymore?(10/20/2008) World of Warcraft anticipation: 6/20 top sales are Blizzards!
(12/15/2008) Why can I run every game but Spore locks up my computer?(10/14/2008) World of goo!
(10/12/2008) Call of Duty: World At War (where to buy)(10/09/2008) Call of Duty: World at War Hands-On Preview
(10/02/2008) Problem with World in Conflict(05/15/2009) Why Windows 7 is going to fail for gaming and more...
(09/10/2008) Mercenaries 2: World in Flames Review(09/09/2008) What are Spore's real world minimum system specs?
(08/29/2008) Logitech Profiler no go Crysis on XP Pro X64. WHY?(09/05/2008) Why do I lost sound on Vista in games?
(08/23/2008) Why the demand for very high FPS in games?(07/17/2008) Why does Activision/Blizzard make sense?
(07/19/2008) Call of Duty: World at War Preview(08/03/2008) Mercenaries 2: World In Flames
(07/15/2008) Crysis stutters on my new rig. Why?(07/02/2008) World of WarCraft Security on a Keychain
(05/16/2008) Best PC Gamepad Controller and Why?(05/09/2008) please help...trading starcraft bttlenet key for Warcraft key
(05/08/2008) Why can't I run crysis at high settings?(05/04/2008) Why Movie Tie-In Games Suck
(04/02/2008) Why all the PC game bashing? PC > consoles(06/13/2008) Why Video Game Stories are "Stupid"
(07/03/2008) Am I screwed in the world of Oblivion?(02/07/2008) Low frame rate World in conflict
(10/02/2009) Why in the Hell do people play WOW?(07/09/2008) World of Warcraft Help Needed Please..
(11/26/2007) Crysis Wars, World in Crysis?(11/12/2007) warcraft III CD broken, how to play BNET?
(11/14/2007) world of warcraft corrupted file(10/17/2007) Why isn't American Conquest More Popular?
(10/30/2007) Why was HL2 E2 in a Orange Box!(10/11/2007) world in conflict
(10/07/2007) World in Conflict, blue screen(10/03/2007) Why does the PC gaming industry make it so hard to be honest?
(10/01/2007) World in Conflict Review(10/04/2007) World in Conflict, anyone ?????
(09/14/2007) Why will Bioshock not start?(09/10/2007) Help with Vista for PacMan World 2
(09/13/2007) Why Buy a Gaming Keyboard?(09/19/2009) World of Warcraft graphics vs. other mmorpg's
(08/22/2007) Far Cry. Why is it lagging!(08/15/2007) Image Preview: World In Conflict
(08/05/2007) Why is my raptor slowing oblivion?(02/15/2008) New World of WarCraft Expansion Unveiled
(08/07/2007) Why would anyone buy at Console 1280 x 720?(08/17/2007) Why don't they put CD keys on the CD cover?
(07/07/2007) World in Conflict beta..Need vista to play??(09/07/2009) Windows Vista with Warcraft 3
(05/22/2007) warcraft 3 cdkey(05/26/2007) SupCom... Why so system intensive... LAG on 6-10 player LAN
(06/21/2007) Why is Counter Strike Source So Popular?(03/22/2007) warcraft movie
(03/24/2007) Why do my games keep randomly freezing?(04/11/2007) WHY WONT THIS WORK!?!?!?!? PLEASE HELP!!
(02/16/2007) Why doesn't Team Fortress 2 have any females?(02/06/2007) Tom Mustaine Talks About SiN Episodes, Severity and Why He Left Ritual
(03/17/2007) The PS3 Why You SHOULD GET ONE(01/24/2007) Back to the Old Republic: Inside the World of "Star Wars" Comic Books
(02/25/2007) World of Warcraft 2(03/08/2007) Warcraft 3 question
(12/08/2006) Significant World of Warcraft Duping Bug Found(12/19/2006) World of Warcraft BC, 1280x1024 MAX, 1gb or 2gb ram?
(12/25/2006) World of Warcraft: Trouble in Azeroth?(08/18/2009) World of Warcraft Singleplayer
(06/25/2007) Why won't LucasArts make a modern Tie Fighter game ?(11/10/2006) Oliver Stone Talks 'World Trade Center,' Controversy and Iraq with David O. Russ
(11/09/2006) Harlan Ellison Interviews Ronald D. Moore on Why "Battlestar Galactica" is So Da(11/15/2006) MMR: Why Video Games Based on Movies Aren't Working
(10/02/2006) World of Warcraft on South Park(10/11/2008) World of Warcraft frame rate cap with Core 2 Duo
(09/17/2006) Why are my steam games closing down when i join a server?(12/22/2008) Battlenet patch error in Warcraft 3
(09/06/2006) Why such bad ping?(05/25/2009) Expert: 40 Percent of World of Warcraft Players Addicted
(06/29/2006) World of Warcraft Cheats, Hacks, Exploits(10/02/2006) World of Warcraft patch WoW-1.11.0-enUS-patch direct link
(08/30/2009) Guild Wars vs. World of Warcraft(10/19/2009) Playing World of Warcraft on a Laptop???
(11/26/2006) Monday Morning Rundown: Ten Reasons Why You Don't Need a PlayStation 3(06/01/2006) Why is that ?
(05/22/2008) World War 2 RTS Command and Conquer Style(05/12/2006) WARCRAFT 3 504t router
(04/13/2006) World basketball manager(06/04/2009) Horrible FPS during Oblivion/FEAR Gameplay. Why??
(04/06/2006) Why is Oblivion running slow?(04/10/2006) Tron's World
(03/11/2006) World of Warcraft grosses 90M last MONTH(03/03/2006) Why won't the tickrate increase?
(06/13/2006) Why Sony Remodel the PS2?(01/28/2006) Runescape World!
(02/11/2006) WoW = World of Waiting(09/12/2005) Pacman World 2 passwords for GBA?
(02/11/2006) Problems with Warcraft 3 - Need help!!!(02/09/2006) World of Warcraft
(12/30/2005) Why is Elhan so angry?(09/18/2005) Is the Play the World opening movie available anywhere?
(08/21/2005) Customize World(08/12/2005) World Map
(08/12/2005) World Map(01/30/2005) Why I can't host in Civ3-PTW?
(12/14/2004) Real World Map for Civ3???(09/25/2004) Please email me pediacons file for Play the World
(08/05/2004) Why don't you and him fight, I'll direct traffic.(05/07/2004) Play the World and other online adventures!
(04/19/2004) Play the World NO CD 127 Patch?(09/20/2005) world of warcraft
(08/21/2005) There IS justice in the world(08/06/2005) Why am I doing this?
(08/01/2005) new World Event!(04/19/2005) Why do players do that?
(02/09/2005) Popular Noob Question(01/21/2005) Why I think Blizzard had released D3 already
(12/01/2004) D2 in German game mag: Why that patch?(06/28/2005) FA: World Heroes SFC
(06/21/2005) Latest Done Fast Videos: Super Mario World 2, Werewolf, Il..(06/15/2005) Webmaster world...
(06/14/2005) Nintendo World(05/10/2005) Nintendo World
(03/03/2005) Super Mario World done fast(03/01/2005) Why was Castlevania: Legends removed from continuity?
(09/27/2005) WTB: Rampage World Tour PCB(09/24/2005) WTB: Rampage World Tour PCB
(09/23/2005) Demon's World PCB Wanted.(09/09/2005) WTB: Sega World Series 01' or 99'
(08/10/2005) Why won't Q*bert save high scores?(08/06/2005) Eighty-year-old Florida video gamer looks to reclaim world..
(07/17/2005) Tech: Why is this???(07/13/2005) FOUND: Asteroids machine that Scott Safran used for world ..
(06/17/2005) WTB: World Series 99 kit or complete game(06/09/2005) Tech: 'Antennae' on some of the older games. Why?
(06/07/2005) Difference between World Class Bowling and the deluxe vers..(05/27/2005) FS: World Class Bowling pcb....
(05/27/2005) FS. in michigan "tecmo world cup" soccer arcade game(05/06/2005) TECH: Why Roadblasters or Roadrunner might not work on you..
(03/30/2005) Why Are All The Good Deals In Cali. When I'm In MI? But I ..(03/21/2005) FA: Cruis'n World marquee
(03/20/2005) did world series baseball have any side art?(03/16/2005) FS: Cruisin' World: Chicago
(03/15/2005) Which is better? Cruis'n World or Sega Rally Championship?(03/12/2005) WTB: Cinematronics World Series Manual, Flyer and CPO
(03/09/2005) Why did the Tac-Scan only sell for $250?(09/23/2005) Wanted: Demon's World PCB.
(09/04/2005) FA: World Class Bowling Deluxe Upgrade/Conversion Chipset(06/12/2005) TECH: Cruisin World blacks out
(05/19/2005) Your Ticket to the 2005 World Series of Poker(05/08/2005) Atari World Rally - Price Check
(04/20/2005) Cruis'n World pcb for sale(03/22/2005) Tech: Cruisin World Monitor
(03/14/2005) Which is better? Cruis'n World or Sega Rally Championship?(09/24/2005) The World Quiz League is back
(09/17/2005) The World Quiz League: Relaunch(04/18/2005) Hey- I want a free IPOD, Why not you.
(04/06/2005) Why are disks called drives?(12/02/2004) World Trivia Tournament
(05/29/2004) The World Quiz League(04/21/2004) Quiz Ten: The World Quiz League
(04/14/2004) World Quiz League: quizmaster vacancy(04/11/2004) World's Brainiest?
(12/27/2004) World Quest RPG Alpha(10/21/2004) Article -- O Brave New World! Why the Type I.5 Changes Are..
(10/12/2004) Invite to Wargames World Forums(09/29/2005) Breath of Fury/Master Warcraft
(11/29/2004) World Championship 2003 pre-con decks(12/21/2004) Why you buy too many Magic cards
(11/23/2004) "Enchant world" vs. legendary enchantments(10/12/2004) Invite to Wargames World Forums
(09/27/2004) Why do people steal!!!(07/04/2005) VTES Players Of The World Unite!
(04/14/2005) Why all the double-postings?(02/22/2005) [LSJ] Why a new clan in KMW?
(02/21/2005) Why on earth has WW not reprinted DECAPITATE?(10/12/2004) Invite to join Wargames World Forums
(07/27/2004) F/S WORLD'S BEST EXTERIOR BALLISTICS SOFTWARE ON PALM PDA ..(09/27/2005) Why can't rogues steal?
(08/31/2005) Why not use a forum?(07/16/2005) Why do nurses disappear?
(07/04/2005) ARGH!! How in the world do you ever ascend?(06/25/2005) Why do all extinctionists seem to be wizards?
(06/16/2005) Why? WHY!?!?(05/20/2005) [S] Why does Slash'EM do this?
(05/18/2005) Why some rooms are lit/unlit(05/10/2005) Why do some kills leave corpses and some don't?
(05/03/2005) Why are priests of your alignment hostile on Astral plane?(04/09/2005) Why did I not get what I wished for? (mildly spoily)
(04/20/2005) Why are some of the artifacts clearly superior to others?(09/22/2005) World Structure
(09/11/2005) How World of Warcraft balances it's items?(05/24/2005) Reasons for random world generation
(05/19/2005) Chicken and Egg Problem of World Generation(05/18/2005) Why no non-keyboard characters?
(05/20/2005) [crawl] YACD - Insanity is hoping for the World Darts Cham..(01/14/2005) Unreal World 2.80
(06/19/2004) [crawl] Why no Ogre-Mage Death Knight?(07/06/2005) Why I hate this game...
(06/13/2005) [V3.0.5] Why can't I enchant Cambeleg?(05/02/2005) Why should i play Angband?
(07/31/2005) Why am I unable to post anything?(09/24/2005) 1978 world cup soccer
(09/24/2005) 1978 world cup soccer(09/23/2005) Water World Question
(09/25/2005) FS/FT: World Cup Soccer 94(09/21/2005) So it's a 'keeper'... Why? (long)
(09/21/2005) Anyone here ever dealt with World Wide Pinball???(09/16/2005) Good price for a Jurassic Park Lost World?
(09/13/2005) TECH: Bally Lost World wire help(09/16/2005) Bally Lost World ring list
(09/13/2005) Fifa World Cup Soccer Bill Acceptor??(09/13/2005) Pinbnall leg mount part needed for my World Cup Soccer '94
(09/09/2005) Got myself a Lost World(08/29/2005) Why is Shaggy so Surprised? Another Piece...
(08/24/2005) WT: World Cup Soccer 94 Replacement ball(08/24/2005) Contest: Why is Shaggy so Surprised?
(08/18/2005) Pinball World Cup pics & results(08/20/2005) Why is Stern so Secretive?
(08/15/2005) WTB: Super Mario Mushroom World (smaller yellow version)(08/10/2005) Walt Disney World (Orlando, FL) pin report
(08/08/2005) Komplett - Miss World pinball - details needed(08/06/2005) Pinball World Cup Update
(08/05/2005) Pinball World Cup rules & regulations(08/03/2005) WTB: World Cup Soccer (Bally) pinball transformer
(08/01/2005) FA: Bally Lost World(08/02/2005) Pinball World Cup update:
(07/29/2005) Why I could never do pinball as a business (long)(07/24/2005) JOHN DAYHUFF: Great friend and asset to this world of Pinb..
(07/20/2005) WTB: World Fair and Ice Revue backbox(07/20/2005) WTB: Gottlieb World Fair backglass
(07/20/2005) World Cup 94 - Blowing fuses(07/19/2005) World Cup '94 Power Issue
(07/19/2005) FS: 1957 Gottlieb World Champ $1000(07/20/2005) Why a big pinball collection?
(07/16/2005) I have Bally Lost World for trade in PA Looking for workin..(08/12/2005) Why can't Americans get Grand Prix?
(07/15/2005) Playmatic "New World" Schematics ?(07/16/2005) Why is all the reverse engineering of pinball in Europe?
(07/13/2005) Why do people hate LW3 ?(07/11/2005) WTB: Gottlieb World Fair backglass
(07/09/2005) FS Alvin G. Al's Garage BAnd Goes on World Tour(07/06/2005) PAPA 8 World Pinball Championships - August 11-14, 2005
(07/03/2005) Why would someone do this?(06/30/2005) FS/FT: World Cup 94 in Richmond,VA
(06/26/2005) FS/FT !994 Bally World Cup Soccer - $1,850 central NJ 08619(06/26/2005) FS/FT !991 Bally World Cup Soccer - $1,850 central NJ 08619
(06/25/2005) FS: Working Cruis'n World Board Set W/Harnesses & Shifter(06/26/2005) FS: Strange World Cabinet Stencils (for purple only)
(06/23/2005) Raresst game in the world to be at pinball expo!(06/16/2005) WTB: Super Mario Brothers Mushroom World
(06/17/2005) What is the rarest game in the world?? It Probably will be..(06/15/2005) TZ Background Music: Golden Earring? Why not Iron Maiden's..
(06/13/2005) Ebay Huh? Is this worth that much? Why?(07/07/2005) [40k] Forge World's latest
(06/24/2005) Why do New Zealanders find Americans so fascinating?(06/06/2005) [INQ] Why is the protection offered by force fields random?
(05/25/2005) Warhammer World Poster - Recent(04/06/2005) [Ad] 20% off GW Post Free World Wide
(05/01/2005) Wargames World Spring Sale(10/12/2004) Invitation to join Wargames World Forums
(09/30/2004) [SWP] New Wargames World Website(05/01/2005) Wargames World Spring Sale
(04/05/2005) Wargames World - Online Improved Functionality(10/12/2004) Invitation to join Wargames World Forums
(10/07/2004) Service Announcement : Wargames World Online(10/06/2004) World Championships at Derby last weekend
(08/15/2004) Opinions of Miniature World Makers Products and service?(05/16/2004) Why are so many wargamers losers with no social skills?
(04/23/2004) Miniature World USA Contact info needed(10/27/2004) World's total population of mahjong players (was "Mahjong ..
(04/23/2004) World's total population of mahjong players - Re-visit(08/02/2005) Most popular interpreters?
(06/07/2005) Why are there no interactive fiction games on the XBOX ???(02/08/2005) Discussion: Why I'm not fond of mechanical puzzles
(12/08/2004) 1893: A World's Fair Mystery update(11/24/2004) Why my room descriptions are so small
(08/11/2004) Why I love interactive fiction and why you should send me ..(07/23/2004) Why does everone dump on Paul Allen Panks?
(06/21/2004) Why is IF so hard?(10/12/2004) Invite to Wargames World Forums
(05/07/2005) More Mutants for Gamma World(04/13/2005) Gamma World D20 Player's Handbook Free
(09/20/2005) Why does Magery no longer add to Skill?(03/18/2005) Best Rat Killer? - Traveller world development question
(02/08/2005) Gurps Gamma World(01/19/2005) Ring of Lend Energy (Why use powerstones?)
(09/27/2005) world dipcon 2002(08/15/2005) World DipCon Results Posted (at least general scores)
(01/27/2005) World Game Needs Australia(01/26/2005) World Game Needs Replacements
(01/12/2005) Diplomacy World #92 Available NOW!(12/04/2004) New World Order
(11/17/2004) Variant World 2101(11/18/2004) Diplomacy Variant - World 2101
(10/12/2004) Dip World Tournament Vacancies(07/22/2004) World Dip Con
(07/16/2004) DIPLOMACY WORLD #90 on Yahoogroups, soon to be on regular ..(07/05/2004) World Variant Needs a Mexico
(06/25/2004) World Game Needs a Replacement(05/18/2004) Why no talks before retreats and adjustments?
(08/23/2005) Why are they doing this to us?(07/27/2005) Movie makes of the World!!!
(04/11/2005) world of warcraft(03/17/2005) Why didn't they have "character portraits" for Ultima 8?
(08/26/2005) Unheralded Zappa wins 2005 World Computer Chess Championship(06/10/2005) Why not Chess18 instead?
(05/01/2005) 13th World Championship(07/02/2005) First Chess960 Computer World Championship - Huge response
(07/22/2005) Why I will never buy another Retail Add-on Aircraft...(06/13/2005) FS9 AND REAL WORLD WEATHER
(06/02/2004) real world weather(05/24/2004) Why my aok wont install :(
(08/04/2005) Matrixgames at the World Boardgame Championships(07/13/2005) World in Flames on track again ?
(06/22/2005) WINSPMBT: Why are some screen resolutions grayed-out?(02/03/2005) What the World Needs Now
(09/14/2005) Why no "Rebelstar" for the PC?(08/25/2005) List of most popular online RTS?
(08/07/2005) HOMM 3 : "World of Darkness" User-Map Review(06/10/2005) Deuteros - Why are they all hacked?
(07/04/2005) World Chamionship Snooker 2005(09/21/2004) Why isn't this forum more active?
(08/07/2004) Why no sound in X2?(09/07/2005) World of warcraft new
(08/21/2005) Why won't Deekin identify anymore?(06/22/2005) World of Warcraft seems to be a great success.
(06/11/2005) World of Warcraft: really WOW or all hype?(05/26/2005) World of warcraft - coordinates
(05/07/2005) Your most impressive/immersive 3D gaming world(s)?(04/09/2005) World of Warcraft is a Feeling.
(03/26/2005) Whats wrong with the world.(03/26/2005) [WoW] How I got World of Warcraft to run on Linux
(03/21/2005) Baseball Mogul 2006: The World's First Baseball RPG?(03/05/2005) !! DOWNLOAD THE MOST POPULAR 2005's CRACKED SOFTWARE(CAD/C..
(02/17/2005) World of Warcraft Blog(02/02/2005) WOW: World of Warcraft, Ebay and Selling your Game Box + A..
(02/01/2005) World Of Warcraft is owned by Sony?(05/03/2005) Why X-Plane is not mentionned on this newsgroup ?
(02/26/2005) Why don't some add-on A/C work as AI in FS9?(02/12/2005) Whats Going on in the world of Flight Sims?
(06/02/2005) Interesting game in Alice in Wonderland world(06/02/2005) Interesting game in Alice in Wonderland world
(06/02/2005) Interesting game in Alice in Wonderland world(06/15/2005) Why no Co-op Adventure games??
(06/08/2005) Why no Still Life discussion ??(03/30/2005) Computer Gaming World Adventure Game of The Year?
(02/02/2005) another world pc game help(08/05/2005) BF2 Why no voice
(07/22/2005) Why do they make 512MB GeForce 6200 AGP parts but not 6800?(07/15/2005) Why so many objections to Steam?
(07/02/2005) Consolists of the world unite!(07/01/2005) Why Johnny Can't Play (25 to Life)
(03/07/2005) Why do action-games lower your IQ ???(02/02/2005) Nooooooooo ASE WHY?
(02/03/2005) Why Half-Life 2 is so great(05/15/2005) [othello] Ben Seeley, double world champion plays versus C..
(09/06/2005) Where can I find popular mods?(10/03/2004) Why no one plays rtcw Degeneration :(
(03/05/2005) Selling large World of Darkness collection on ebay in 6 lots(02/08/2005) [Mage] Why did no one inform me about the old school ST sc..
(11/04/2004) [newbie] World of Darkness, need some information please(10/15/2004) Old World Of Darkness Story Teller Hints
(10/25/2004) Sky Captain & The World of Tomorrow(08/28/2004) The New World of Darkness and Happiness.
(08/26/2004) The New World of Darkness Hoax.(08/18/2004) First Print of World of Darkness Rulebook Sold Out
(08/17/2004) First Print of World of Darkness Rulebook Sold Out(08/21/2004) First Print of World of Darkness Rulebook Sold Out
(08/12/2004) Why should I play Exalted?(07/28/2004) New World of Darkness Game Line All Hardcover; White Wolf ..
(07/12/2004) Page Count Rises on World of Darkness Rulebook $19.99 Pric..(06/23/2004) FA: World of Darkness Collection!
(06/22/2004) FA: World of Darkness Collection!(06/03/2004) New World of Darkness Character Sheet posted
(05/26/2004) Why I feel bad for my Exalted players.(05/14/2004) (eBay) More VtES, Gamma World, Scarred Lands.
(04/27/2004) (eBay) VtES, Gamma World, Scarred Lands, and more.(12/28/2004) Witch World(FGU) - Ever published?
(08/03/2004) Matrix Games Marches to World Boardgaming Championships 20..(09/01/2005) Aggramar World Server Down
(08/27/2005) Warcraft III backup files(08/27/2005) warcraft 3 movies
(08/17/2005) world of warcraft 300+ exploits for leveling and gold-making(08/18/2005) world of warcraft 300+ exploits for leveling and gold-making
(08/14/2005) world of warcraft 300+ exploits(08/10/2005) world of warcraft 300+ exploits
(08/06/2005) world of warcraft 300+ exploits(08/05/2005) world of warcraft 300+ exploits
(08/05/2005) world of warcraft 300+ exploits(08/04/2005) world of warcraft 300+ exploits
(08/04/2005) Warcraft 3: Night Elf Final Mission(07/27/2005) Why ...
(07/22/2005) Brief history of Warcraft game versions sought(07/08/2005) World of Guilds launches recruiting feature
(06/28/2005) warcraft 2 windowed?(06/27/2005) Warcraft 3 ROC stollen
(06/24/2005) World of Warcraft is(06/29/2005) can world of warcraft be played online?
(06/11/2005) world of warcraft just bought it(06/21/2005) were the diablo games set in the warcraft world ?
(06/02/2005) Warcraft bug(06/02/2005) I want to play Warcraft ... where do I begin?
(05/09/2005) How do you progress in a PvP world?(02/19/2005) Why play somewhere the charges you. Check Out teamxlink
(07/20/2004) Tetris world help!(08/24/2005) Why not use an iPod as an X360 HD?
(08/13/2005) 'World of Mana' (a new Seiken Densetsu ! ) to span multipl..(08/06/2005) What the online world really needs...
(06/01/2005) Midway Arcade Classics 2 Rampage World Tour question selec..(05/17/2005) Release Dates For Xbox 360 - Have World Wide Release Dates..
(04/08/2005) Is the world ready for X-Box 360?(03/13/2005) Hey- I want a free IPOD, Why not you.
(03/01/2005) Hey- I want a free IPOD, Why not you.(02/03/2005) World Championship Poker
(09/17/2005) Why didn't people leave New Orleans?(08/12/2005) Why do people....
(08/04/2005) 'World of Mana' (a new Seiken Densetsu ! ) to span multipl..(07/30/2005) Why does everyone in here always....
(04/15/2005) Why aren't EYETOY games made available to US consumers?(04/08/2005) Why no TOSHINDEN for PS2???
(03/27/2005) Why no custom soundtracks on PSP?(03/28/2005) Why cant they make all PS2 games able to use the keyboard ..
(03/27/2005) PSP WHY?(03/19/2005) Fifa 2005 or world soccer for the psp?
(09/01/2005) Today's top 10 most popular portable games!(08/16/2005) Nintendo World in NYC
(02/14/2005) Why does it appear everyone is anti-nintendo?(01/03/2005) Why I support nintendo
(12/18/2004) PoP:WW - Why no discussion?(08/20/2005) 'World of Mana' (a new Seiken Densetsu ! ) to span multipl..
(06/17/2005) pac man world(05/11/2005) Another World on GBA
(07/28/2004) FS: GBA, and Super Mario World Advance 2 Cheap!(07/28/2004) FS: GBA, and Super Mario World Advance 2 Cheap!
(07/18/2004) Size-stripped game performs badly? Why?(09/14/2005) Why are my cruisers intercepting wings?
(06/02/2005) Why would one ever turn off ion cannon (Large Weapons)?(04/24/2005) Training World
(04/28/2005) Why can't we go back...(09/13/2004) World Map
(05/21/2005) World Series of Poker and the World Poker Tour Grand Prix ..(06/02/2004) Connection failed... WHY?
(05/21/2005) World Series of Poker and the World Poker Tour Grand Prix ..(12/13/2004) Why are my bots so stupid and theirs so smart?
(04/24/2005) Thief 4 - Why Not try this instead ?(10/02/2004) T:DS - Auldale - Faction/Pagans Uhh they killed me. Why ?
(08/31/2004) Why does god hate me? 


Sponsored links
  • Ask the community now
  • Publish
Ad