Why does 8800gtx beat 2900xt


 

 
More related threads to : Why does 8800gtx beat 2900xt
(06/26/2008) Feeling Vindicated for buying 8800GTX(07/02/2008) Why does DVI/HDMI look worse than VGA on my HDTV
(06/29/2008) 8800GTX Suddenly Not Performing (Help)(06/23/2008) 8800gtx --> 2x4850 @ P35 ?
(06/22/2008) Odd Display glitch with 8800GTX(06/22/2008) R700 will beat 2x280 in sli
(06/24/2008) 8800GT OC vs 8800GTX(06/23/2008) Official Benchmarks: Radeon 4850/70 PWNAGE! (Anand does it!)
(06/16/2008) Does the Syncmaster 930b (samsung monitor) support SLI?(06/13/2008) Why are people so excited about crossfire on HD 4000s?
(06/13/2008) Does this 3dMark look ok for my setup?(06/08/2008) can some1 plz help? 8800gtx problems
(06/07/2008) 8800gtx performance problems(06/06/2008) Nvidia driver installation failure..also poor 8800gtx performance
(06/06/2008) If you have two GPUs and the mobo that does not contain SLI technology(06/03/2008) Does anyone know the story on the Asus EN9800GX2 TOP/G/2DI/1G ?
(06/01/2008) cheap 2900xt.... Worth it?(05/31/2008) help with an 8800gtx
(05/27/2008) 9800GTX vs 8800GTX(05/27/2008) A question about my 8800GTX temps.
(05/23/2008) Screen corruption with DUAL-VSTA and Forceware > 100.x Why, ASROCK? ?(05/23/2008) 9800GTX vs 8800GTX
(06/11/2008) Stable 790i, Quad-SLI Config - does anyone have one?(05/19/2008) How much video memory does your graphics card have?
(05/20/2008) 8800gtx vs 9800 gtx... for HDTV? So Confused.(05/19/2008) Why not GT(X)?
(06/11/2008) Running 3 screens on 8800GTX(05/17/2008) One card for boot up - One for playtime - does this work?
(05/15/2008) HD 2900XT problems or normal?(05/15/2008) 8800gtx won't detect hdtv
(05/19/2008) 8800GT-OC and 8800GTX(05/12/2008) 8800GTX vs ultra
(05/11/2008) Why does my graphics lag?(05/12/2008) manufacture brand DOES matter!!
(05/13/2008) Windows XP does now see all memory(05/10/2008) 8800GTX SLI horizontal lines
(05/07/2008) Does MSI void warrantys for overcloking video cards??(05/07/2008) Does Loading BIO Alter Clock Settings???
(05/06/2008) 8800GTX & 8500GT Conflicting causing BSOD(05/05/2008) Does using 2 monitors slow down games?
(05/04/2008) Does 8800 GTX supports any motherboard with a PCI-E slot?(05/02/2008) Sufficient PSU for 8800GTX?
(05/01/2008) 8800GTX Mini-speaker(04/30/2008) 8800GTX Wont stop Screeching, Help pls.
(04/30/2008) EVGA 8800GTX NO SIGNAL PLEASE HELP(04/28/2008) 8800GT / 8800GTS / 8800GTX
(04/24/2008) Does disabling SLI cut power to the second card?(04/24/2008) How does VGA render a frame?
(04/24/2008) Why doesn't visiontek X1650 PRO work ?(04/20/2008) Does this 3DMark seem oke?
(04/19/2008) 8800gtx / 9800gtx/gx2 *OR* New CPU and MB?(04/21/2008) XFX 8800GTX bootup issues
(04/24/2008) 8800gtx or 9800gtx?(04/15/2008) Does CPU speed affect SLi scaling?
(04/17/2008) Why do you choose your respective company (nVidia / ATi)(04/14/2008) Does this even sound right? XP vs Vista 3dmark - my scores
(04/08/2008) Why is this XFX 8800gts 320 mb so much more $$?(04/07/2008) nVidia 8800GTX question
(04/07/2008) 8800gtx or 8800gt(04/08/2008) 8800GTX V 9800GTX V 2 X 8800GT
(04/05/2008) Why do we need 3dmark08 when we have Crysis?(04/04/2008) Why im I not able to play crysis on high with my system?
(04/03/2008) My monitor connector does not fit into my computer(04/01/2008) 8800gtx cooler
(04/01/2008) Why the massive price difference in workstation/gaming cards?(04/01/2008) Uninstalling a 8800GTX
(03/31/2008) Why Would you rather a GTS(G92) instead a 8800GTX(04/02/2008) FPS, does it really matter?
(03/26/2008) Triple Display with 8800GTX(03/26/2008) used XFX 8600GT 256M GDDR3 for 40Euro. does it worth the price?
(03/26/2008) psu for 8800gtx(03/24/2008) No tv out on 8800gtx
(03/25/2008) Why no reviews on all purpose cards?(03/25/2008) 2x 8800gtx or 9800gx2
(03/22/2008) Does grahpics memory make a difference with the same resolution?(03/29/2008) Why does the TV wonder 650 have such bad picture quality?(satelite)
(03/22/2008) Does SLI/Crossfire require game support?(03/21/2008) Please set me straight, 8800GTX vs. 8800GTvs.8800GTS vs.9600
(03/23/2008) Very Tempting Step-Up: 8800GTX for a 9800GX2?(03/23/2008) Why SHOULDN'T you get a 9800GX2
(03/21/2008) Can I run 2 8800GTX in SLI wth 700W Seasonic?(03/26/2008) GeForce 8800GTX: activate DVD decoding
(03/17/2008) 8800GTX SLI vs 9800GTX SLI(03/23/2008) Does anyone know where I could get a 24" Non-TN LCD for under $500?
(03/23/2008) Does ATI AIW X800XT work with ECS K7S5A Pro Rev.5.0?(03/14/2008) Asus Extreme 3870X2 VS BFG 8800GTX OC2
(03/12/2008) -2x- 9600GT 512MB 8800GTX 768MB(03/10/2008) Why do 8800 640 gts's still cost more than 8800GT's ??!! :fou:
(03/09/2008) 8800GTX Running Very Hot(03/10/2008) Does anyone know of a good SLI Benchmark WebSite?
(03/11/2008) 8800GTS (512 MB) vs. 8800GTX (768 MB)(03/04/2008) Why ati9xxzx fail more oftenly then others?
(03/14/2008) Going from 8800GTX to SLi'd GTXs, anything needed?(03/27/2008) eVGA GeForce 8800GTX 768MB for $299.99! (free shipping)
(02/29/2008) 8800GTS 512MB or 8800GTX 768MB?(03/07/2008) 8800GT in SLI,3DMARK06 Score, does this seem kinda low?
(02/28/2008) 8800GTS VS 8800GTX(02/26/2008) get another 8800GTX ANS3 for SLI or get new CPU & mobo?
(02/23/2008) Does Blu-ray use HDCP protection yet(02/23/2008) Why is ATI 3870 so slow?
(03/17/2008) Does 3850 need an aftermarket cooler?(02/19/2008) Why is there no Dual or Quad core GPU's.
(02/16/2008) 8800GTX > 8800GTS(G92)?(02/15/2008) Why bother? huh
(02/14/2008) Dual 8800GT's or Single 8800GTX(02/25/2008) Which drivers are the best for a 2900xt?
(02/22/2008) 8800gtx+HDTV+HDMI-DVI cables(02/14/2008) 8800GTX problems
(02/13/2008) How Much Video Ram does a man need?(06/05/2008) 1080p with 8800gtx !?
(02/09/2008) What does it take to power the beast?(02/12/2008) Why is my 3dmak score so low (8800gts (g92)
(02/11/2008) Does overclocking EVGA 8800gt void the warranty(02/09/2008) CrossfireX - does 4 GPU's mean 4 'X2's or 4 GPU's total
(02/07/2008) 8800GTX and 939 mobo(02/07/2008) Why Widescreen?
(02/05/2008) at what resolution does sli benefit?(03/09/2008) Does the 8800GT support a resolution of 1280*800?
(02/03/2008) Why does 8.1 drivers make my1950GT AGP perform badly(01/31/2008) Why does my 8600GT shows 512 mb but it is only 256mb
(01/29/2008) 8800GTX Faster than 3870 X2 ?!?(01/27/2008) Does BFG Ageia PhysX Accelerator actaully help?
(01/28/2008) Good 8800GTX Brand(01/25/2008) Does anyone use "Omega" drivers for Nvidia Cards?
(01/24/2008) Difference between these EVGA 8800GTX video cards?(01/30/2008) Damaged DVI port? 2900xt
(01/24/2008) XFX 8800GTX versus XFX 8800GTS G92 - which is better?(01/20/2008) Why wont Ntune or Riva tuner work with my pc...?
(01/19/2008) Why is a 8800gt better than a 3870?(01/18/2008) Diablo 2 limited to 25 fps on 8800GTX ?
(01/17/2008) 8800GTX temperature(01/24/2008) 8800GTX vs. 3870 X-Fire
(01/15/2008) Why 2 power leads?(06/18/2008) PCI-e x16 on PCI-e x1 slot. Does it work?
(01/15/2008) Does these FPS seem right (crysis)(01/14/2008) CrossFire question: does it support multiple monitors?
(01/12/2008) For a Single Card, Does it Matter Which Slot...(01/11/2008) Does size really matter? For monitors I mean!
(01/10/2008) Does quad sli work for 7950gx2(01/10/2008) X1900CF or 8800GTX....
(01/09/2008) 8800GTX/slow downs(01/11/2008) Why don't Vista and 2600 XT handle HDMI LCDs (HP w2207h)?
(01/10/2008) When does "Ghosting" Occur?(01/05/2008) GEFORCE 9800X2 does support Quad SLI
(01/06/2008) Why bother playing in ultra high resolutions?(01/03/2008) How low does the price on GTS 320's have to go...
(12/31/2007) does your card do this??(12/31/2007) How much power does 3850 need?
(12/28/2007) Does anyone know when the nvidia 9800 is comming out?(12/23/2007) Beyond Nehalem and Fusion where does NVIDIA fit in?
(12/22/2007) Anyone know when there will come a 8800GTX PCI Express2.0?(12/21/2007) Another 8800gtx or wait for new cards??
(12/20/2007) Does Nvidia Control panel have an option to set up multiple displays?(12/31/2007) How does 2 8500s (512mb in sli stack up against an 8800gt or an hd3850
(12/20/2007) 2900XT/3850/3870 x24 AA?(12/19/2007) 8800GTX single or dual for dell 30" monitor?
(12/17/2007) Why is my AGP card at 4x bandwidth?(12/16/2007) Need Help to Underclock 8800gtx KO3
(12/15/2007) Does SPARKLE GeForce 8800GT Cool-pipe 3 really exist?(12/12/2007) 8800GTX Equivalent?
(12/11/2007) Does an ATI x1650 have enough horsepower for Vista?(12/19/2007) XFX 8800GTX Extreme 768 HIGH temps!
(12/06/2007) Where does Tom get these retail prices?!(12/05/2007) Does anyone know if any more cards are coming?
(12/05/2007) Why no good nVidia next gen GPU info from Tom's?(12/04/2007) Ati 2900xt vs 1900xt crossfire
(01/06/2008) 2 x 2900Pros in Crosssfire OR 1 x 8800GTX - what do you think?(12/03/2007) Antecs 850 v 8800GTX
(12/02/2007) 8800 does'nt detect hdtv(12/01/2007) Does any 1 have experience changing Geforce->Quadro FX/ Radeon->FireGL
(12/01/2007) New G92 GTS 512 does it beat old GTS 640mb?(12/02/2007) 2x3870's in CF slower than 8800gtx?
(11/29/2007) Does video card need to be installed for computer to power up?(05/08/2008) Why is my Overclocked 8800gt having problems running Oblivion on High?
(11/25/2007) WHY does an 8800GT crush 8600gt SLI'd?(11/23/2007) Vista x64 Display Driver Error - 8800gtx
(11/23/2007) Why is 3870 Better Than 8800GT?(11/29/2007) Why is 8800gt better than 3870??
(11/20/2007) [8800GTX] worth selling to get 2 x 8800GT?(11/18/2007) Why can't I get a 3DMark06 score in XP?
(01/23/2008) Best VGA cooler for the 8800GTX(11/16/2007) 8800GTX Heat Issue
(11/16/2007) 2x 8800GT or 1x 8800GTX ???(11/16/2007) Replace 8800gtx with 2 amd's ? worth it?
(11/17/2007) What does it mean for 720p to be 1080i compatible?(01/25/2008) ATI's 38xx beat Nvidia in total cost of ownership
(11/15/2007) Does this 3dmark06 score sound right for evga 8800GT KO and 3.6 E6850?(11/16/2007) When does the ATi 3800 series get released?
(11/21/2007) Dual 7900gs or single 8800gtx?(11/11/2007) 3DMark06 Score Dropped - WHY?
(11/13/2007) Is this overclocked 8800GTX safe for air cooling?(11/10/2007) 2900xt probelm and crashing
(11/09/2007) AS5 to cool down 8800gtx?(11/09/2007) Ok, so processor does make a big difference
(11/03/2007) Does "passive cooling" on high-end video cards work?(11/03/2007) 8800GTX - low '06 SM3.0 score - any thoughts
(12/11/2007) 8800gtx Ripple/Stutter, whatever this is! help!(11/04/2007) Why so much hate on motion blur?
(11/22/2007) 8800GTX out of the box running slower than it should be?(11/06/2007) 8800gtx causing system lock ups under load
(10/31/2007) 8800GTX, Speaker goes off while running ATITool scan(10/31/2007) bottle necking e6600 with 2 8800gtx in sli?
(12/19/2007) Does nVidia release MCP72's and MCP78's Geforce number?(10/28/2007) Few questions on 8800GTX
(10/28/2007) does mobo chipset matter in non-SLI/XFIRE configs?(10/27/2007) 3 monitors per computer? / what does Quadro mean? / is PCI-Ex1 superio
(10/29/2007) Why must data sent from VGA to monitor be at fixed frequencies?(10/26/2007) Performance problems on EVGA 8800gtx
(10/27/2007) Does Nvidia offer OEM 8700M GT's?(06/05/2008) What is bottlenecking my 8800gtx? Help please!
(10/21/2007) does SLI mode can be use with video edting?(10/20/2007) >> 8800GTX dimensions. will it fit in my case?
(10/18/2007) Diamond ATI HD 2900XT crashesssssssss(11/06/2007) ATI 2900XT 1GB and half life 2 not DX10?
(10/20/2007) 8800GTX OC - A new adventure(10/18/2007) Interesting read UT3 and 2900xt..Getting better?
(10/18/2007) Is it worth downgrading from 2900XT 512 to 8800 GTS 320(10/14/2007) So it looks like the 2950XT will approach or beat the 8800GTX
(10/14/2007) Does It worth to buy a 8800gtx from a 8800gts 320mb?(10/18/2007) I Can't Justify Buying An 8800GTX
(10/07/2007) ATI 2950XT to beat the 8800GTX?(10/05/2007) Build a system now with 8800GTX or wait for 9800GTX?
(10/04/2007) How well does the x1900xt run now compared to current gen cards?(10/03/2007) gddr4 2900 pro compared to 2900xt gddr3?
(10/03/2007) Why is Sapphire #1?(10/02/2007) 8800GTX and 8800Ultra SLI Question
(10/03/2007) Low 3dmark score on my rig :( Why?(10/03/2007) My 8800gtx heat up badly using DX10
(09/29/2007) nvidia monitor 8800GTX voltage(09/28/2007) Can someone help me clock this 2900XT?
(09/28/2007) 1gig 2900xt Crossfire problems(09/28/2007) Single 8800GTX for 2560x1600?
(09/27/2007) MSI NX8800GTX-T2D768E-HD-OC OR EVGA 8800GTX??(10/01/2007) Best 'old' AGP VC that does not need PS power ?
(09/26/2007) Does the Samsung 245b support 1:1 pixel mapping(09/26/2007) BFG 7800GTX OC PCI-e Does not support dual link?
(09/26/2007) 2900 Pro X-fire or single 8800GTX for about the same price?(09/25/2007) Question about temperatures and size of PNY NVIDIA 8800GTX 764MB
(09/24/2007) 8800gtx SLI poor performance when using anti-aliasing(09/24/2007) Need capture device that does higher resolutions
(09/24/2007) Anyone Running 2900XT w/ 24inch Monitor?(09/23/2007) 7950GT to a 8800GTX Superclocked, Will it work!?
(09/22/2007) QUAKE WARS VGA SHOOTOUT , Bad for 2900XT good for 88xx(09/21/2007) its the lastest ATI Catalyst 7.9 released does any good to my 1600?
(09/21/2007) 8800GTX case compatibility(09/22/2007) Had enough of G9x. Got a 8800GTX!
(10/30/2007) why does my geforce 8800 gtx xxx hard freezes my comp all the time?(09/22/2007) 2900xt on an nvidia chipset.
(09/18/2007) New Dell9200, 8800GTX - 3DMARK06(09/16/2007) HD 2900XT + 1920x1200
(09/17/2007) 8800GTS vs 8800GTX(09/14/2007) FPS for 8800GTX
(09/13/2007) Resoultion Q: 22"LCD, 8800GTX(09/13/2007) 1950XTX Crossfire vs. Single nVidia 8800GTX
(09/13/2007) Looking for AGP card that does component out(09/13/2007) Can the HD2900XT Perform on Par with 8800GTX?
(10/19/2007) Cat 7.9 and 2900XT 1GB crossfire -- huge improvement(09/11/2007) Should I Buy The HD 2900XT?
(09/10/2007) does evga allow overclocking? (searched, no result)(09/11/2007) Can I handle a 8800GTX?
(09/10/2007) Pixel bleeding problem on 8800GTX, 3007WFP-HC(09/09/2007) 7900 series beat 8800gts?
(09/05/2007) 8800GTX SLI or 8800ULTRA xxx(09/04/2007) 8800GTX SLI - Worth it in Vista? Power Requirements?
(09/05/2007) Does anyone know when PCI Express Version 2 compliant graphic cards wi(09/07/2007) My OCZ 8800GTX OCing results
(09/14/2007) What's better, 2*8800GTS (SLI) or single 8800GTX?(09/06/2007) 8800GTX good with an Amd64X2 4400+?
(08/31/2007) I got punk'd! 8800GTX help!(08/30/2007) Buying 8800gtx. Will it work with...
(08/30/2007) 8800GTS 640MB vs 2900XT 512MB(08/30/2007) The Debate - 8800GTS vs 2900XT
(08/30/2007) 8800GTX Overclocking in Vista(08/29/2007) 7800GTX SLI to 8800GTX
(08/28/2007) 8800gtx vs 7900gtx core clock(09/01/2007) Why is it that the 320 mb 8800gts beats the 640 mb one in performance?
(08/24/2007) Buy HD 2900xt or not???(09/04/2007) GTS 320Mb Vs GTS 640Mb Vs 2900XT
(09/15/2007) Best VGA cooler for 8800GTX?(08/23/2007) Why more cards available w/ fan than w/ passive heatsink (fanless)?
(08/22/2007) 8800GTX PSU?(08/22/2007) Why eVGA?
(08/21/2007) 8800GTS 640 vs 8800GTX?(08/18/2007) 2900xt CF on dual x16 (at x38 chipset)
(08/18/2007) 2900xt temp? issue. Please help(08/18/2007) PSU to weak for a 2900XT?
(08/17/2007) Why are my 8800gts temps so high?!!!(08/16/2007) Couple 2900xt guestions (not certain if mine is working well)
(08/15/2007) What are the benefits of SLI 8800GTX?(08/16/2007) 8800gts 640mb vs 2900xt?
(08/14/2007) 8800GTS 640XXX vs 8800GTX 768 normal(08/15/2007) Does Riva Tuner allow fixed fan control on SLI
(08/10/2007) PSU and 8800GTX(08/11/2007) 2900xt Sapphire or asus?
(08/11/2007) Need advice on a PSU purchase (related to a 2900xt)(09/11/2007) hd 2900xt wierd problem. Need help pls!
(08/04/2007) Is my power supply enough for a 2900xt?(08/04/2007) Should I step up from 8800GTX to 8800 Ultra?
(08/04/2007) how much is a 8800gtx sli going to cost?(08/03/2007) Will a HD 2900XT fit inside a p182?
(08/22/2007) EVGA 8800GTX MODDING(08/01/2007) xfx 8800gtx xxx instalation
(08/02/2007) Why Ati 2600XT sucks???(08/01/2007) 8800GTX Power Connectors - Need Both?
(08/02/2007) 2900XT Crossfire vs 8800GTS SLI(08/01/2007) Isnt the 2900xt faster than the gts now?
(07/30/2007) What Nvidia card does a x1900 Crossfire compare to?(07/29/2007) What does Alter DVI operational mode do in the ati CCC?
(07/30/2007) 8800 gts 640mb or 2900xt?(07/28/2007) which is better for vista? 8800 gts or 2900xt?
(07/28/2007) Computer does not restart after upgrading GPU, but can turn off and on(07/28/2007) What drivers are YOU using? And Why?
(07/27/2007) Does overclocking my evga gpu void the warrenty??(07/27/2007) Radeon HD 2900XT issues under WinXP
(07/26/2007) PSU for 2900XT(07/26/2007) 8800GTX crash OR faulty PSU?
(07/25/2007) help buying new graphics, 2900xt or 8800gts or 8800gtx(07/25/2007) My new video card BFG 8800GTX OC
(07/24/2007) 3DMark06 and 2900XT problems?(07/24/2007) what card should i get? hd 2900xt 512mb or 8800gts 640mb superclocked
(07/24/2007) 8800 gts...what does anti-analyzing do?(07/23/2007) Help with a 8800GTX
(07/24/2007) EVGA 8800GTX KO ACS3 or EVGA 8800GTX Superclocked?(07/20/2007) Extreme PC HD 2900XT
(07/19/2007) 2900xt vista problems still(07/27/2007) 8800gtx 768mb or SLI 8800gts 320mb
(07/25/2007) Worth upgrading from 8800gts 320mb to 8800gtx ?(07/18/2007) M2N32-SLI Deluxe Mobo, ATI 2900 or 8800gtx
(07/17/2007) 2900XT or 8800GTS Superclocked 640MB (same price)(07/13/2007) Anyone try 7600GT and 8800GTX with XP?
(07/13/2007) Does anyone know how to open games in a small window?(07/14/2007) Which is better 8800GTX or 8800Ultra?
(07/11/2007) power 2900XT(07/11/2007) 2900XT or 8800GTS more futureproof?
(07/10/2007) Stock 8800gtx vs most expensive 8800 ultra:(07/10/2007) How much hotter is an 8800GTX superclocked than 8800GTX stock?
(07/07/2007) XFX 8800GTS XXX (1500Mhz Shader) Vs 8800GTX (1350Mhz Shader)(07/06/2007) 4870 in 3d mark06 with 8800gtx
(07/06/2007) New ATI CCC does it have a spy ware file?(07/05/2007) Radeon HD 2900XT 1024MB GDDR4 vs. 8800GTX IN VISTA!!
(07/06/2007) HD2900XT xfire up to 3x faster than 8800GTX sli under Vista(07/02/2007) Benchmark for 2900XT 1 Gb GDDR4??? Where????
(07/02/2007) 2 8800GTS 640's or 1 8800GTX?(06/28/2007) Power supply suitable for 8800GTX ?
(06/29/2007) 1024mb 2900xt tested(06/26/2007) 2900XT set 3DMark05 World Record!!!!!!!!
(06/24/2007) Sapphire HD 2900XT Overclocking(06/21/2007) Why Use an HDTV Dongle?
(07/20/2007) 2900XT vs 8800GTS compared in terms of cars(06/25/2007) 8800gtx x 1 VS 8800gts x 2 SLI (VS ATI cards)
(06/21/2007) 8800GTX(06/20/2007) 8800gtx price...
(06/26/2007) 2900XT Game Benchies (not a sad joke)(06/18/2007) I have 8800GTX, should i buy a PhysX card?
(06/17/2007) 2900XT cooler(06/17/2007) What is the point of the 2 SLi connectors on the 8800GTX?
(06/17/2007) Radeon 2900XT VS XFX8800GTS(06/16/2007) Only your drivers will tell the story. 2900XT
(06/16/2007) Asus 8800GTX AquaTank or Asus 8800Ultra(06/15/2007) the 2900XT 1Gb is out really The World Fastest ???
(06/14/2007) Why cant I max out stalker to the fullest with my rig?(06/13/2007) What does the KO and AC3 mean?
(06/14/2007) 2900XT the engine they say couldn’t compete!(06/23/2007) 8800GTX SLI problem. Help please!!!!!
(06/11/2007) Why is my SLI rig producing bad FPS?(06/21/2007) HD 2900XT, rate how bad this card sucks! or not?
(06/08/2007) ATI 2900XT 1GB Benches - 3DMark Only - for now(06/11/2007) 3dmark06 results with 2900xt CF this time
(06/07/2007) How do I check my 8800GTX SLI GPU temperature?(06/08/2007) 2900xt vs 8800gts 640mb ocied version... help Plz?
(06/07/2007) Why Today's Graphics Card Market Sucks(06/05/2007) hd 2900xt power question :( (and 8800gts 320mb bootleneck)
(06/06/2007) 8800gtx or 9800gtx?(06/05/2007) I'm getting black screens on res switches w/my 8800GTX
(06/05/2007) Why does all movies on my pc only play in black and white?(06/04/2007) 2900XT 1gig DDR4 scores are out
(06/03/2007) Does this mean that the card is near its end?(06/03/2007) 8800gtx or sli 8800gts
(06/02/2007) Why 2 graphics cards?(06/02/2007) Advice SLI 8800GTX with Dual-Link 30" Monitor
(06/02/2007) 8800GTX KO ACS3 + HR-03 Plus(06/01/2007) 8800gtx for MSI RS480-M2-IL
(06/01/2007) 1GB GDDR4 Radeon HD 2900XT next month ?(05/31/2007) Does it come down to price?
(05/30/2007) my new diamon 2900xt is not working doa help(05/30/2007) X1950Pro -> 2900xt?
(05/30/2007) FX-55 and 8800GTX.Will it be bottlenecked?(06/09/2007) X-Bit Labs review of the ATI 2900XT is it better than 8800?
(05/27/2007) Ati 2900xt. Buy now, or wait for later??(05/26/2007) 8800gtx Draw Distance Problems!
(05/31/2007) 8800gtx + 19" CRT or 8800gts 640mb + 22"LCD(05/24/2007) will i be ok with 8800gtx
(05/25/2007) 8800gtx slow in Nfs Carbon & Most Wanted(05/22/2007) Horrid 2900xt vista 64 performance
(05/22/2007) How does and would a 8800gts run 1080p?(05/24/2007) 8800GTS 640 vs HD 2900XT
(05/21/2007) Will a 4800 X2 @ 3GHZ bottleneck a ATI 2900XT 512 MB(05/20/2007) 2900XT and Hiper Type R Modular
(05/20/2007) New Built PC Slow and Does Not Play DVD's!(05/22/2007) 2900XT 3D Mark Glitch
(05/20/2007) Lost planet Dx10 Demo on 2900xt(05/19/2007) 2900XT - More or Less Power?
(05/21/2007) 2900xt performing worse than x1800xt in oblivion(05/20/2007) Does ATI and NVIDIA have a PPU onboard the graphics card?
(05/18/2007) Which 8800GTX?(05/17/2007) 8800GTX and Vista 64bit Clockspeed question
(05/16/2007) Why is my card taking up all my system RAM(05/20/2007) 8800GTX Spanking 2900XT in first DX10 DEMO LOST PLANET
(05/16/2007) does my upgrade fall short ?(05/15/2007) Which eVGA 8800GTX has the better cooler
(05/14/2007) 8800GTX V 2900XT ???(05/15/2007) Any 8800GTX Price Drops cause of R600?
(05/14/2007) Inconsistent frames on my new 8800GTX?(05/15/2007) Finally HD 2900xt at newegg for $409
(05/14/2007) Reviews of Radeon HD 2900XT(05/14/2007) Is only the HD 2900XT coming out tomorrow?
(05/14/2007) 2900XT review on vr-zone(05/13/2007) What does eVGA do with the used graphics cards from Step Up?
(05/13/2007) 2900XT's at Zip zoom, come and get em(05/12/2007) 8800GTX
(05/11/2007) MSI HD 2900XT Watercooled (Inq)(05/14/2007) PICS of dx10 ruby demo (running on 2900XT)
(05/11/2007) Why 2 SLI connectors on each 8800gtx but only 1 SLI bridge?(05/12/2007) X1950 AGP does not resume from S3 suspend
(05/13/2007) R600 beats 8800GTX?(05/14/2007) What card should I get? ATI 2900XT or Nvidia 8800GTX.
(05/10/2007) 2 monitors... 8800GTS 640MB SLI or 1 8800GTX?(06/06/2007) How does eVGA's 'step up' program work?
(05/09/2007) where does the 8800gts 320mb come on the vga chart?(05/09/2007) Difference between eVGA 8800GTX Superclocked and ACS3?
(05/09/2007) MSI 2900XT pics(05/08/2007) Another 2900xt bench-yes it's Fudzilla; who else.
(05/08/2007) Does this card exist?(05/09/2007) Geforce 8800GTX and SLI
(05/06/2007) Exactly how does this thing work?(05/05/2007) XFX 8800GTX XXX O/C edition support Dual, dual link!!!!!!!!!
(05/06/2007) NCIX 2900xt US @ CDN prices posted(05/04/2007) Fudzilla Radeon HD 2900XT heats up to 82 degrees C
(05/04/2007) Why can't I play games on new Forceware drivers?(05/04/2007) HD 2900XT UPDATE
(05/04/2007) Fudzilla:Radeon HD 2900XT needs 750W+(05/03/2007) Nvidia 8800GTX and Radeon HD 2900 XT power consumption?
(05/02/2007) ATI bundles Half Life 2 Ep 2 with HD 2900XT, well a voucher.(05/02/2007) 8800GTX 10.5 inches or 11
(05/02/2007) Dual monitor aspect changing on 8800GTX...(05/01/2007) EVGA 8800GTX Question
(05/01/2007) Does Anyone Know Whats Wrong(04/30/2007) Who would buy 2900xt CF?
(04/29/2007) About to Buy 8800gtx SLI Dilema(04/30/2007) HD 2900XT Crossfire benchies???
(04/28/2007) CAN MY FX60 PUSH 8800GTX in SLI(04/28/2007) a question about the e-GeForce 8800GTX 768MB KO ACS3
(04/27/2007) HD 2900xt vs. 8800gtx! fake?(04/26/2007) Aftermarket cooling for 8800GTX or stick with stock?
(04/25/2007) How does HDCP work?(04/26/2007) Pre Order your Sapphire HD 2900XT euro 380
(04/25/2007) 1 8800GTX or 2x8800gts(320mb) in SLI(04/24/2007) Why does tom's hardware use crappy old games to benchmark?
(04/25/2007) ATI HD 2900xt benchmark(04/27/2007) Hmm.. Should I wait for the 2900XTX or go with the 2900XT?
(04/25/2007) Powering 2 quad-cores and an 8800GTX(04/24/2007) Need a 8800gtx, but which 1 ?
(04/24/2007) 8800GTX OR 8800Sirocco(04/22/2007) Does the 7300GT support widescreen resolutions?
(04/21/2007) which 8800gtx card?(04/25/2007) Why such poor performance for the 7950 GX2?
(04/22/2007) Does Monitor Affect the Way you PLAY?(04/19/2007) Does 8800 support purevideo?
(04/21/2007) No XFX 8800GTX @ Newegg?(04/21/2007) So how does one go about using the step up program?
(04/20/2007) 8800GTX Performing as it should??(04/21/2007) ATI 2900XT.. POST ALL THE PICS U HAVE AND ANY NEW INFO!!!
(04/18/2007) 8800GTX Really Worth It?(04/18/2007) 8800GTX dual monitor problem?
(04/16/2007) 8800GTX dimensions(04/15/2007) Does video memory matter? 512meg vs 768 meg?
(04/14/2007) problem with my 8800gtx(04/26/2007) 2900XT And 8800GTX Crysis demo bench
(04/14/2007) Holy.... does the cry engine 2 look amazing...or what?!(04/14/2007) 8800gtx quick question
(04/14/2007) Bench results: R600 -vs- 8800GTX in 3DMark2006.(04/17/2007) HD 2900xt looks good!!!
(04/14/2007) 8800gtx. Worth it ?(04/12/2007) worth the difference (8800gtx question)
(04/11/2007) Macs suck in graphics, WHY ?(04/14/2007) F8ck 8800gtx
(04/10/2007) Yeah...so I am an idiot (8800GTX help)(04/08/2007) Card Manufactures, does it matter?
(04/06/2007) Slot cooler for 8800GTS & 8800GTX(04/11/2007) wow amd does somthing right! R600 has always been ready?
(04/06/2007) Does intel 965 Chipset support SLI or is it Crossfire only?(04/29/2007) Does Chipset-to-GPU Matching Matter?
(04/06/2007) is it just me or does the ps3 freaking lag!?!?!(04/03/2007) 2 sli connectors on the 8800gtx wtf?
(03/31/2007) 8800GTX 6-pin power connector(03/29/2007) Why?
(03/28/2007) Why are games always fullscreen(03/31/2007) Why does bf2 not run well?
(03/31/2007) Does any ATI card vendor have a step-up program? 


Google Ads